C22H36O4 — CID 163185536
(4S,6R,9R,10R,11R)-11,13-dimethoxy-6-methyl-9-[(2S)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-ene (PubChem CID 163185536) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (4S,6R,9R,10R,11R)-11,13-dimethoxy-6-methyl-9-[(2S)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-ene.
| Compound Name | (4S,6R,9R,10R,11R)-11,13-dimethoxy-6-methyl-9-[(2S)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-ene |
|---|---|
| PubChem CID | 163185536 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (4S,6R,9R,10R,11R)-11,13-dimethoxy-6-methyl-9-[(2S)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-ene |
| SMILES | COC1O[C@@H](OC)[C@H]2C1=CC[C@@H]1O[C@]1(C)CC[C@@H]2[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C22H36O4/c1-14(2)8-7-9-15(3)16-12-13-22(4)18(26-22)11-10-17-19(16)21(24-6)25-20(17)23-5/h8,10,15-16,18-21H,7,9,11-13H2,1-6H3/t15-,16+,18-,19+,20?,21+,22+/m0/s1 |
| InChIKey | NNEPDNCQXXTAGG-VFINXDFISA-N |
| XLogP | 4.84 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|