C21H22O6 — CID 163185674
(7R,8S,9R)-9-(1,3-benzodioxol-5-yl)-4-methoxy-7,8-dimethyl-7,8-dihydro-6H-benzo[g][1,3]benzodioxol-9-ol (PubChem CID 163185674) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (7R,8S,9R)-9-(1,3-benzodioxol-5-yl)-4-methoxy-7,8-dimethyl-7,8-dihydro-6H-benzo[g][1,3]benzodioxol-9-ol.
| Compound Name | (7R,8S,9R)-9-(1,3-benzodioxol-5-yl)-4-methoxy-7,8-dimethyl-7,8-dihydro-6H-benzo[g][1,3]benzodioxol-9-ol |
|---|---|
| PubChem CID | 163185674 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (7R,8S,9R)-9-(1,3-benzodioxol-5-yl)-4-methoxy-7,8-dimethyl-7,8-dihydro-6H-benzo[g][1,3]benzodioxol-9-ol |
| SMILES | COc1cc2c(c3c1OCO3)[C@](O)(c1ccc3c(c1)OCO3)[C@@H](C)[C@H](C)C2 |
| InChI | InChI=1S/C21H22O6/c1-11-6-13-7-17(23-3)19-20(27-10-26-19)18(13)21(22,12(11)2)14-4-5-15-16(8-14)25-9-24-15/h4-5,7-8,11-12,22H,6,9-10H2,1-3H3/t11-,12+,21-/m1/s1 |
| InChIKey | KCYVBPCJWBVYJQ-SMDDFHAHSA-N |
| XLogP | 3.22 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |