C22H32ClNO5 — CID 163185720
(2E,10E)-N-[(2R,3S,4aS,8R,8aR)-8-chloro-2,4a-dihydroxy-8a-methyl-5-oxo-2,3,4,8-tetrahydrochromen-3-yl]dodeca-2,10-dienamide (PubChem CID 163185720) has the molecular formula C22H32ClNO5 and a molecular weight of 425.95 g/mol. Its IUPAC name is (2E,10E)-N-[(2R,3S,4aS,8R,8aR)-8-chloro-2,4a-dihydroxy-8a-methyl-5-oxo-2,3,4,8-tetrahydrochromen-3-yl]dodeca-2,10-dienamide.
| Compound Name | (2E,10E)-N-[(2R,3S,4aS,8R,8aR)-8-chloro-2,4a-dihydroxy-8a-methyl-5-oxo-2,3,4,8-tetrahydrochromen-3-yl]dodeca-2,10-dienamide |
|---|---|
| PubChem CID | 163185720 |
| Molecular Formula | C22H32ClNO5 |
| Molecular Weight | 425.95 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (2E,10E)-N-[(2R,3S,4aS,8R,8aR)-8-chloro-2,4a-dihydroxy-8a-methyl-5-oxo-2,3,4,8-tetrahydrochromen-3-yl]dodeca-2,10-dienamide |
| SMILES | C/C=C/CCCCCC/C=C/C(=O)N[C@H]1C[C@@]2(O)C(=O)C=C[C@@H](Cl)[C@]2(C)O[C@H]1O |
| InChI | InChI=1S/C22H32ClNO5/c1-3-4-5-6-7-8-9-10-11-12-19(26)24-16-15-22(28)18(25)14-13-17(23)21(22,2)29-20(16)27/h3-4,11-14,16-17,20,27-28H,5-10,15H2,1-2H3,(H,24,26)/b4-3+,12-11+/t16-,17+,20+,21-,22+/m0/s1 |
| InChIKey | SMQUWAPDCGSDCO-IRWUAVPDSA-N |
| XLogP | 2.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.95 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|