C19H18O6 — CID 163187607
7-[[(2R,3R)-3-methyl-3-[[(2R)-4-methylidene-5-oxooxolan-2-yl]methyl]oxiran-2-yl]methoxy]chromen-2-one (PubChem CID 163187607) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-[[(2R,3R)-3-methyl-3-[[(2R)-4-methylidene-5-oxooxolan-2-yl]methyl]oxiran-2-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[(2R,3R)-3-methyl-3-[[(2R)-4-methylidene-5-oxooxolan-2-yl]methyl]oxiran-2-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 163187607 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 7-[[(2R,3R)-3-methyl-3-[[(2R)-4-methylidene-5-oxooxolan-2-yl]methyl]oxiran-2-yl]methoxy]chromen-2-one |
| SMILES | C=C1C[C@H](C[C@@]2(C)O[C@@H]2COc2ccc3ccc(=O)oc3c2)OC1=O |
| InChI | InChI=1S/C19H18O6/c1-11-7-14(23-18(11)21)9-19(2)16(25-19)10-22-13-5-3-12-4-6-17(20)24-15(12)8-13/h3-6,8,14,16H,1,7,9-10H2,2H3/t14-,16-,19-/m1/s1 |
| InChIKey | BSQOZNKTJBOYCC-IDHHARJASA-N |
| XLogP | 2.59 |
| TPSA | 78.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|