C19H20O7 — CID 124630714
7-[[(2S,3S)-3-[[(2R,4S)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one (PubChem CID 124630714) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is 7-[[(2S,3S)-3-[[(2R,4S)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one.
| Compound Name | 7-[[(2S,3S)-3-[[(2R,4S)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 124630714 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 7-[[(2S,3S)-3-[[(2R,4S)-4-hydroxy-4-methyl-5-oxooxolan-2-yl]methyl]-3-methyloxiran-2-yl]methoxy]chromen-2-one |
| SMILES | C[C@]1(O)C[C@H](C[C@]2(C)O[C@H]2COc2ccc3ccc(=O)oc3c2)OC1=O |
| InChI | InChI=1S/C19H20O7/c1-18(22)8-13(24-17(18)21)9-19(2)15(26-19)10-23-12-5-3-11-4-6-16(20)25-14(11)7-12/h3-7,13,15,22H,8-10H2,1-2H3/t13-,15+,18+,19+/m1/s1 |
| InChIKey | UMYAEKVHXDURJS-UVDFWXMISA-N |
| XLogP | 1.79 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|