C16H23NO3 — CID 163187929
(1S,4R,6S,9S,11S)-2,11-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-14-en-8-one (PubChem CID 163187929) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is (1S,4R,6S,9S,11S)-2,11-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-14-en-8-one.
| Compound Name | (1S,4R,6S,9S,11S)-2,11-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-14-en-8-one |
|---|---|
| PubChem CID | 163187929 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | (1S,4R,6S,9S,11S)-2,11-dihydroxy-4-methyl-13-azatetracyclo[7.7.0.01,6.02,13]hexadec-14-en-8-one |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@H]3C[C@H](O)CN4C=CC[C@]23C4(O)C1 |
| InChI | InChI=1S/C16H23NO3/c1-10-5-11-6-14(19)13-7-12(18)9-17-4-2-3-15(11,13)16(17,20)8-10/h2,4,10-13,18,20H,3,5-9H2,1H3/t10-,11+,12+,13-,15+,16?/m1/s1 |
| InChIKey | GQAHQMIJHHYCCJ-FRAXZAFRSA-N |
| XLogP | 1.28 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |