C17H27NO2 — CID 162902580
(1S,2R,4R,6R,9R)-2-hydroxy-6-methyl-13-azatetracyclo[11.3.1.01,9.04,9]heptadecan-8-one (PubChem CID 162902580) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (1S,2R,4R,6R,9R)-2-hydroxy-6-methyl-13-azatetracyclo[11.3.1.01,9.04,9]heptadecan-8-one.
| Compound Name | (1S,2R,4R,6R,9R)-2-hydroxy-6-methyl-13-azatetracyclo[11.3.1.01,9.04,9]heptadecan-8-one |
|---|---|
| PubChem CID | 162902580 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (1S,2R,4R,6R,9R)-2-hydroxy-6-methyl-13-azatetracyclo[11.3.1.01,9.04,9]heptadecan-8-one |
| SMILES | C[C@H]1CC(=O)[C@@]23CCCN4CCC[C@]2(C4)[C@H](O)C[C@H]3C1 |
| InChI | InChI=1S/C17H27NO2/c1-12-8-13-10-14(19)16-4-2-6-18(11-16)7-3-5-17(13,16)15(20)9-12/h12-14,19H,2-11H2,1H3/t12-,13-,14-,16+,17+/m1/s1 |
| InChIKey | VALUWIQMFMRUMN-VJDWVQAOSA-N |
| XLogP | 2.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |