C19H22O6 — CID 163188113
[(4R,10Z,11aR)-4-acetyloxy-6,10-dimethyl-2-oxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-3-yl]methyl acetate (PubChem CID 163188113) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is [(4R,10Z,11aR)-4-acetyloxy-6,10-dimethyl-2-oxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-3-yl]methyl acetate.
| Compound Name | [(4R,10Z,11aR)-4-acetyloxy-6,10-dimethyl-2-oxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 163188113 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [(4R,10Z,11aR)-4-acetyloxy-6,10-dimethyl-2-oxo-4,5,9,11a-tetrahydrocyclodeca[b]furan-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C2[C@@H](/C=C(/C)CC=C=C(C)C[C@H]2OC(C)=O)OC1=O |
| InChI | InChI=1S/C19H22O6/c1-11-6-5-7-12(2)9-17-18(16(8-11)24-14(4)21)15(19(22)25-17)10-23-13(3)20/h5,9,16-17H,7-8,10H2,1-4H3/b12-9-/t6?,16-,17-/m1/s1 |
| InChIKey | ILGAJWKWEBJQAQ-AYAAJPIVSA-N |
| XLogP | 2.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|