C22H22O8 — CID 163189735
4-(1,2-dihydroxyethyl)-4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 163189735) has the molecular formula C22H22O8 and a molecular weight of 414.41 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)-4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 4-(1,2-dihydroxyethyl)-4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 163189735 |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)-4-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(C=CC(=O)C(O)(C(=O)C=Cc2ccc(O)cc2)C(O)CO)ccc1O |
| InChI | InChI=1S/C22H22O8/c1-30-18-12-15(4-9-17(18)25)6-11-20(27)22(29,21(28)13-23)19(26)10-5-14-2-7-16(24)8-3-14/h2-12,21,23-25,28-29H,13H2,1H3 |
| InChIKey | JHDAVTOBIFNIPF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|