C14H16O8 — CID 154732301
(E,2R)-2-[(1R)-1,2-dihydroxyethyl]-2-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-3-oxopent-4-enoic acid (PubChem CID 154732301) has the molecular formula C14H16O8 and a molecular weight of 312.27 g/mol. Its IUPAC name is (E,2R)-2-[(1R)-1,2-dihydroxyethyl]-2-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-3-oxopent-4-enoic acid.
| Compound Name | (E,2R)-2-[(1R)-1,2-dihydroxyethyl]-2-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 154732301 |
| Molecular Formula | C14H16O8 |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (E,2R)-2-[(1R)-1,2-dihydroxyethyl]-2-hydroxy-5-(4-hydroxy-3-methoxyphenyl)-3-oxopent-4-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)[C@@](O)(C(=O)O)[C@H](O)CO)ccc1O |
| InChI | InChI=1S/C14H16O8/c1-22-10-6-8(2-4-9(10)16)3-5-11(17)14(21,13(19)20)12(18)7-15/h2-6,12,15-16,18,21H,7H2,1H3,(H,19,20)/b5-3+/t12-,14+/m1/s1 |
| InChIKey | QQENQWUEGFWBOM-ZPSXMKBBSA-N |
| XLogP | -0.85 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|