C15H18O8 — CID 22482502
(E)-5,6,7,8-tetrahydroxy-1-(4-hydroxy-3-methoxyphenyl)oct-1-ene-3,4-dione (PubChem CID 22482502) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is (E)-5,6,7,8-tetrahydroxy-1-(4-hydroxy-3-methoxyphenyl)oct-1-ene-3,4-dione.
| Compound Name | (E)-5,6,7,8-tetrahydroxy-1-(4-hydroxy-3-methoxyphenyl)oct-1-ene-3,4-dione |
|---|---|
| PubChem CID | 22482502 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (E)-5,6,7,8-tetrahydroxy-1-(4-hydroxy-3-methoxyphenyl)oct-1-ene-3,4-dione |
| SMILES | COc1cc(/C=C/C(=O)C(=O)C(O)C(O)C(O)CO)ccc1O |
| InChI | InChI=1S/C15H18O8/c1-23-12-6-8(2-4-9(12)17)3-5-10(18)13(20)15(22)14(21)11(19)7-16/h2-6,11,14-17,19,21-22H,7H2,1H3/b5-3+ |
| InChIKey | IEPQZIWEKIJAOM-HWKANZROSA-N |
| XLogP | -1.37 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|