C31H50O6 — CID 123258700
22,23,24-trihydroxy-1-(4-hydroxy-3-methoxyphenyl)tetracosa-1,12-dien-3-one (PubChem CID 123258700) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is 22,23,24-trihydroxy-1-(4-hydroxy-3-methoxyphenyl)tetracosa-1,12-dien-3-one.
| Compound Name | 22,23,24-trihydroxy-1-(4-hydroxy-3-methoxyphenyl)tetracosa-1,12-dien-3-one |
|---|---|
| PubChem CID | 123258700 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 22,23,24-trihydroxy-1-(4-hydroxy-3-methoxyphenyl)tetracosa-1,12-dien-3-one |
| SMILES | COc1cc(C=CC(=O)CCCCCCCCC=CCCCCCCCCC(O)C(O)CO)ccc1O |
| InChI | InChI=1S/C31H50O6/c1-37-31-24-26(21-23-29(31)35)20-22-27(33)18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-28(34)30(36)25-32/h2-3,20-24,28,30,32,34-36H,4-19,25H2,1H3 |
| InChIKey | SMROGWAWWIVVKW-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|