C41H56O10 — CID 91022941
[1-hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxohenicos-12-en-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 91022941) has the molecular formula C41H56O10 and a molecular weight of 708.89 g/mol. Its IUPAC name is [1-hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxohenicos-12-en-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [1-hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxohenicos-12-en-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 91022941 |
| Molecular Formula | C41H56O10 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | [1-hydroxy-3-[3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyloxy]-4-oxohenicos-12-en-2-yl] 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)C(OC(=O)C=Cc1ccc(O)c(OC)c1)C(CO)OC(=O)C=Cc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C41H56O10/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-35(45)41(51-40(47)27-23-32-21-25-34(44)37(29-32)49-3)38(30-42)50-39(46)26-22-31-20-24-33(43)36(28-31)48-2/h11-12,20-29,38,41-44H,4-10,13-19,30H2,1-3H3 |
| InChIKey | CCWWIYZQDXRHLI-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|