C31H50O8 — CID 174585441
2,3-dihydroxypropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;(Z)-octadec-9-enoic acid (PubChem CID 174585441) has the molecular formula C31H50O8 and a molecular weight of 550.73 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;(Z)-octadec-9-enoic acid.
| Compound Name | 2,3-dihydroxypropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 174585441 |
| Molecular Formula | C31H50O8 |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 2,3-dihydroxypropyl 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.COc1cc(C=CC(=O)OCC(O)CO)ccc1O |
| InChI | InChI=1S/C18H34O2.C13H16O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-18-12-6-9(2-4-11(12)16)3-5-13(17)19-8-10(15)7-14/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-6,10,14-16H,7-8H2,1H3/b10-9-; |
| InChIKey | WMLYZSSGJCZVJB-KVVVOXFISA-N |
| XLogP | 6.42 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|