C40H30F2N2P+ — CID 163197210
[6,7-bis(4-fluorophenyl)-3-methylquinoxalin-2-yl]methyl-triphenylphosphanium (PubChem CID 163197210) has the molecular formula C40H30F2N2P+ and a molecular weight of 607.66 g/mol. Its IUPAC name is [6,7-bis(4-fluorophenyl)-3-methylquinoxalin-2-yl]methyl-triphenylphosphanium.
| Compound Name | [6,7-bis(4-fluorophenyl)-3-methylquinoxalin-2-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 163197210 |
| Molecular Formula | C40H30F2N2P+ |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | [6,7-bis(4-fluorophenyl)-3-methylquinoxalin-2-yl]methyl-triphenylphosphanium |
| SMILES | Cc1nc2cc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)cc2nc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H30F2N2P/c1-28-40(27-45(33-11-5-2-6-12-33,34-13-7-3-8-14-34)35-15-9-4-10-16-35)44-39-26-37(30-19-23-32(42)24-20-30)36(25-38(39)43-28)29-17-21-31(41)22-18-29/h2-26H,27H2,1H3/q+1 |
| InChIKey | LYULFFQLAUINFK-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|