C25H29N3O6 — CID 163200850
3-[(5,5-dimethyl-6,7-dihydro-4H-1-benzofuran-4-yl)amino]-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]cyclobutane-1,2-dione (PubChem CID 163200850) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-6,7-dihydro-4H-1-benzofuran-4-yl)amino]-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]cyclobutane-1,2-dione.
| Compound Name | 3-[(5,5-dimethyl-6,7-dihydro-4H-1-benzofuran-4-yl)amino]-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]cyclobutane-1,2-dione |
|---|---|
| PubChem CID | 163200850 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 3-[(5,5-dimethyl-6,7-dihydro-4H-1-benzofuran-4-yl)amino]-4-[2-hydroxy-3-(morpholine-4-carbonyl)anilino]cyclobutane-1,2-dione |
| SMILES | CC1(C)CCc2occc2C1NC1C(=O)C(=O)C1Nc1cccc(C(=O)N2CCOCC2)c1O |
| InChI | InChI=1S/C25H29N3O6/c1-25(2)8-6-17-14(7-11-34-17)23(25)27-19-18(21(30)22(19)31)26-16-5-3-4-15(20(16)29)24(32)28-9-12-33-13-10-28/h3-5,7,11,18-19,23,26-27,29H,6,8-10,12-13H2,1-2H3 |
| InChIKey | NYNCRXQNGYWCIS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|