C27H31N3O8 — CID 118797758
methyl (2R)-1-[2-hydroxy-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate (PubChem CID 118797758) has the molecular formula C27H31N3O8 and a molecular weight of 525.56 g/mol. Its IUPAC name is methyl (2R)-1-[2-hydroxy-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[2-hydroxy-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118797758 |
| Molecular Formula | C27H31N3O8 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | methyl (2R)-1-[2-hydroxy-3-[[2-[[(R)-(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN1C(=O)c1cccc(NC2C(=O)C(=O)C2N[C@@H](c2ccc(C)o2)C2(C)COC2)c1O |
| InChI | InChI=1S/C27H31N3O8/c1-14-9-10-18(38-14)24(27(2)12-37-13-27)29-20-19(22(32)23(20)33)28-16-7-4-6-15(21(16)31)25(34)30-11-5-8-17(30)26(35)36-3/h4,6-7,9-10,17,19-20,24,28-29,31H,5,8,11-13H2,1-3H3/t17-,19?,20?,24+/m1/s1 |
| InChIKey | SZZXPBFVESVAMK-MLBAQFORSA-N |
| XLogP | 1.74 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|