C30H37N3O8 — CID 118797757
tert-butyl (2R)-1-[2-hydroxy-3-[[2-[[(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate (PubChem CID 118797757) has the molecular formula C30H37N3O8 and a molecular weight of 567.64 g/mol. Its IUPAC name is tert-butyl (2R)-1-[2-hydroxy-3-[[2-[[(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R)-1-[2-hydroxy-3-[[2-[[(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118797757 |
| Molecular Formula | C30H37N3O8 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | tert-butyl (2R)-1-[2-hydroxy-3-[[2-[[(5-methylfuran-2-yl)-(3-methyloxetan-3-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]benzoyl]pyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(C(NC2C(=O)C(=O)C2Nc2cccc(C(=O)N3CCC[C@@H]3C(=O)OC(C)(C)C)c2O)C2(C)COC2)o1 |
| InChI | InChI=1S/C30H37N3O8/c1-16-11-12-20(40-16)26(30(5)14-39-15-30)32-22-21(24(35)25(22)36)31-18-9-6-8-17(23(18)34)27(37)33-13-7-10-19(33)28(38)41-29(2,3)4/h6,8-9,11-12,19,21-22,26,31-32,34H,7,10,13-15H2,1-5H3/t19-,21?,22?,26?/m1/s1 |
| InChIKey | VUFPYNOUPOQISO-LBZDYYAASA-N |
| XLogP | 2.91 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|