C23H27N3O6 — CID 129012348
2-hydroxy-N,N-dimethyl-3-[[2-[[(5-methylfuran-2-yl)-[(2R)-oxolan-2-yl]methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide (PubChem CID 129012348) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-[[2-[[(5-methylfuran-2-yl)-[(2R)-oxolan-2-yl]methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-[[2-[[(5-methylfuran-2-yl)-[(2R)-oxolan-2-yl]methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide |
|---|---|
| PubChem CID | 129012348 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-[[2-[[(5-methylfuran-2-yl)-[(2R)-oxolan-2-yl]methyl]amino]-3,4-dioxocyclobutyl]amino]benzamide |
| SMILES | Cc1ccc(C(NC2C(=O)C(=O)C2Nc2cccc(C(=O)N(C)C)c2O)[C@H]2CCCO2)o1 |
| InChI | InChI=1S/C23H27N3O6/c1-12-9-10-16(32-12)17(15-8-5-11-31-15)25-19-18(21(28)22(19)29)24-14-7-4-6-13(20(14)27)23(30)26(2)3/h4,6-7,9-10,15,17-19,24-25,27H,5,8,11H2,1-3H3/t15-,17?,18?,19?/m1/s1 |
| InChIKey | FUYIWDWZOHTRJO-XZTPIBBXSA-N |
| XLogP | 1.81 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|