C23H26FN3O6 — CID 118797753
3-[[2-[[[3-(fluoromethyl)oxetan-3-yl]-(5-methylfuran-2-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 118797753) has the molecular formula C23H26FN3O6 and a molecular weight of 459.47 g/mol. Its IUPAC name is 3-[[2-[[[3-(fluoromethyl)oxetan-3-yl]-(5-methylfuran-2-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[[3-(fluoromethyl)oxetan-3-yl]-(5-methylfuran-2-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 118797753 |
| Molecular Formula | C23H26FN3O6 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[[2-[[[3-(fluoromethyl)oxetan-3-yl]-(5-methylfuran-2-yl)methyl]amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | Cc1ccc(C(NC2C(=O)C(=O)C2Nc2cccc(C(=O)N(C)C)c2O)C2(CF)COC2)o1 |
| InChI | InChI=1S/C23H26FN3O6/c1-12-7-8-15(33-12)21(23(9-24)10-32-11-23)26-17-16(19(29)20(17)30)25-14-6-4-5-13(18(14)28)22(31)27(2)3/h4-8,16-17,21,25-26,28H,9-11H2,1-3H3 |
| InChIKey | QAYVRJAZFDSMGE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 121.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|