C16H9FN2O — CID 163212015
6-fluoro-2-phenylfuro[2,3-b]quinoxaline (PubChem CID 163212015) has the molecular formula C16H9FN2O and a molecular weight of 264.26 g/mol. Its IUPAC name is 6-fluoro-2-phenylfuro[2,3-b]quinoxaline.
| Compound Name | 6-fluoro-2-phenylfuro[2,3-b]quinoxaline |
|---|---|
| PubChem CID | 163212015 |
| Molecular Formula | C16H9FN2O |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 6-fluoro-2-phenylfuro[2,3-b]quinoxaline |
| SMILES | Fc1ccc2nc3oc(-c4ccccc4)cc3nc2c1 |
| InChI | InChI=1S/C16H9FN2O/c17-11-6-7-12-13(8-11)18-14-9-15(20-16(14)19-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | QICOUJWUWYWPRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |