C16H13ClO — CID 163216725
3-chloro-10,10-dimethylanthracen-1-one (PubChem CID 163216725) has the molecular formula C16H13ClO and a molecular weight of 256.73 g/mol. Its IUPAC name is 3-chloro-10,10-dimethylanthracen-1-one.
| Compound Name | 3-chloro-10,10-dimethylanthracen-1-one |
|---|---|
| PubChem CID | 163216725 |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 3-chloro-10,10-dimethylanthracen-1-one |
| SMILES | CC1(C)C2=CC(Cl)=CC(=O)C2=Cc2ccccc21 |
| InChI | InChI=1S/C16H13ClO/c1-16(2)13-6-4-3-5-10(13)7-12-14(16)8-11(17)9-15(12)18/h3-9H,1-2H3 |
| InChIKey | NDIDZFMNIQOJED-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |