C9H13N3O — CID 163220857
ethene;N-(2-ethenyl-1-methylimidazol-4-yl)formamide (PubChem CID 163220857) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is ethene;N-(2-ethenyl-1-methylimidazol-4-yl)formamide.
| Compound Name | ethene;N-(2-ethenyl-1-methylimidazol-4-yl)formamide |
|---|---|
| PubChem CID | 163220857 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | ethene;N-(2-ethenyl-1-methylimidazol-4-yl)formamide |
| SMILES | C=C.C=Cc1nc(NC=O)cn1C |
| InChI | InChI=1S/C7H9N3O.C2H4/c1-3-7-9-6(8-5-11)4-10(7)2;1-2/h3-5H,1H2,2H3,(H,8,11);1-2H2 |
| InChIKey | NRHCGBRESSRAAQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|