(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid

C13H13NO3 — CID 163225590

IUPAC(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid
SMILES[H]/N=C/C(=C\C=C\CC(=O)O)Oc1ccccc1
InChIInChI=1S/C13H13NO3/c14-10-12(8-4-5-9-13(15)16)17-11-6-2-1-3-7-11/h1-8,10,14H,9H2,(H,15,16)/b5-4+,12-8+,14-10+
InChIKeyUTOSPVFPXXAQFG-WFCSYFDTSA-N
MW231.25 g/mol
LogP2.63
Rot. Bonds6

About (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid

(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid (PubChem CID 163225590) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid.

Molecular Properties

Compound Name(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid
PubChem CID163225590
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid
SMILES[H]/N=C/C(=C\C=C\CC(=O)O)Oc1ccccc1
InChIInChI=1S/C13H13NO3/c14-10-12(8-4-5-9-13(15)16)17-11-6-2-1-3-7-11/h1-8,10,14H,9H2,(H,15,16)/b5-4+,12-8+,14-10+
InChIKeyUTOSPVFPXXAQFG-WFCSYFDTSA-N
XLogP2.63
TPSA70.38 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.63
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid?
The IUPAC name of (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid (CID 163225590) is (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid.
What is the SMILES notation for (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid?
The canonical SMILES for (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid is [H]/N=C/C(=C\C=C\CC(=O)O)Oc1ccccc1.
What is the InChIKey of (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid?
The InChIKey is UTOSPVFPXXAQFG-WFCSYFDTSA-N. The full InChI is InChI=1S/C13H13NO3/c14-10-12(8-4-5-9-13(15)16)17-11-6-2-1-3-7-11/h1-8,10,14H,9H2,(H,15,16)/b5-4+,12-8+,14-10+.
What are the key properties of (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid?
(3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid has a molecular weight of 231.25 g/mol, XLogP of 2.63, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-7-imino-6-phenoxyhepta-3,5-dienoic acid is sourced from PubChem (CID 163225590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).