C16H20O — CID 142275001
[(3E,5Z)-8-methylnona-1,3,5-trien-3-yl]oxybenzene (PubChem CID 142275001) has the molecular formula C16H20O and a molecular weight of 228.33 g/mol. Its IUPAC name is [(3E,5Z)-8-methylnona-1,3,5-trien-3-yl]oxybenzene.
| Compound Name | [(3E,5Z)-8-methylnona-1,3,5-trien-3-yl]oxybenzene |
|---|---|
| PubChem CID | 142275001 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(3E,5Z)-8-methylnona-1,3,5-trien-3-yl]oxybenzene |
| SMILES | C=C/C(=C\C=C/CC(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-4-15(11-9-8-10-14(2)3)17-16-12-6-5-7-13-16/h4-9,11-14H,1,10H2,2-3H3/b9-8-,15-11+ |
| InChIKey | LZJJDJPXDHRYHX-CKHPGVLBSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|