C25H30N2O7 — CID 163225980
4-benzoyl-N-(2-oxoethyl)benzamide;4-ethoxy-4-methoxy-1-methylpyrrolidine-2-carboxylic acid (PubChem CID 163225980) has the molecular formula C25H30N2O7 and a molecular weight of 470.52 g/mol. Its IUPAC name is 4-benzoyl-N-(2-oxoethyl)benzamide;4-ethoxy-4-methoxy-1-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 4-benzoyl-N-(2-oxoethyl)benzamide;4-ethoxy-4-methoxy-1-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 163225980 |
| Molecular Formula | C25H30N2O7 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-benzoyl-N-(2-oxoethyl)benzamide;4-ethoxy-4-methoxy-1-methylpyrrolidine-2-carboxylic acid |
| SMILES | CCOC1(OC)CC(C(=O)O)N(C)C1.O=CCNC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H13NO3.C9H17NO4/c18-11-10-17-16(20)14-8-6-13(7-9-14)15(19)12-4-2-1-3-5-12;1-4-14-9(13-3)5-7(8(11)12)10(2)6-9/h1-9,11H,10H2,(H,17,20);7H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | DLXPUQOXUFICMK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|