C24H31FN2O5 — CID 163226769
4-(4-fluorophenyl)-1-methylpyrrolidine-2-carboxylic acid;formamide;5-phenoxypentanal (PubChem CID 163226769) has the molecular formula C24H31FN2O5 and a molecular weight of 446.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-methylpyrrolidine-2-carboxylic acid;formamide;5-phenoxypentanal.
| Compound Name | 4-(4-fluorophenyl)-1-methylpyrrolidine-2-carboxylic acid;formamide;5-phenoxypentanal |
|---|---|
| PubChem CID | 163226769 |
| Molecular Formula | C24H31FN2O5 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 4-(4-fluorophenyl)-1-methylpyrrolidine-2-carboxylic acid;formamide;5-phenoxypentanal |
| SMILES | CN1CC(c2ccc(F)cc2)CC1C(=O)O.NC=O.O=CCCCCOc1ccccc1 |
| InChI | InChI=1S/C12H14FNO2.C11H14O2.CH3NO/c1-14-7-9(6-11(14)12(15)16)8-2-4-10(13)5-3-8;12-9-5-2-6-10-13-11-7-3-1-4-8-11;2-1-3/h2-5,9,11H,6-7H2,1H3,(H,15,16);1,3-4,7-9H,2,5-6,10H2;1H,(H2,2,3) |
| InChIKey | NIJXMPWLHIBAQU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|