C18H17N5O2 — CID 163231567
5-(carbamoylamino)-2-methyl-N-(quinoxalin-2-ylmethyl)benzamide (PubChem CID 163231567) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-methyl-N-(quinoxalin-2-ylmethyl)benzamide.
| Compound Name | 5-(carbamoylamino)-2-methyl-N-(quinoxalin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 163231567 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-(carbamoylamino)-2-methyl-N-(quinoxalin-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(NC(N)=O)cc1C(=O)NCc1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H17N5O2/c1-11-6-7-12(23-18(19)25)8-14(11)17(24)21-10-13-9-20-15-4-2-3-5-16(15)22-13/h2-9H,10H2,1H3,(H,21,24)(H3,19,23,25) |
| InChIKey | VYCGXDFYXCWCHK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |