C32H33BF2N2O2 — CID 163232787
2,2-difluoro-4,12-bis[(E)-2-(4-methoxyphenyl)ethenyl]-6,10-dimethyl-8-propan-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 163232787) has the molecular formula C32H33BF2N2O2 and a molecular weight of 526.44 g/mol. Its IUPAC name is 2,2-difluoro-4,12-bis[(E)-2-(4-methoxyphenyl)ethenyl]-6,10-dimethyl-8-propan-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,12-bis[(E)-2-(4-methoxyphenyl)ethenyl]-6,10-dimethyl-8-propan-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 163232787 |
| Molecular Formula | C32H33BF2N2O2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 2,2-difluoro-4,12-bis[(E)-2-(4-methoxyphenyl)ethenyl]-6,10-dimethyl-8-propan-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1ccc(/C=C/C2=[N+]3C(=C(C(C)C)c4c(C)cc(/C=C/c5ccc(OC)cc5)n4[B-]3(F)F)C(C)=C2)cc1 |
| InChI | InChI=1S/C32H33BF2N2O2/c1-21(2)30-31-22(3)19-26(13-7-24-9-15-28(38-5)16-10-24)36(31)33(34,35)37-27(20-23(4)32(30)37)14-8-25-11-17-29(39-6)18-12-25/h7-21H,1-6H3/b13-7+,14-8+ |
| InChIKey | FDXVAZCAGAFZKB-FNCQTZNRSA-N |
| XLogP | 7.71 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|