C30H29NO10S — CID 163236942
tert-butyl N-[(2S)-1-[5-(1,3-dioxo-2-propanoylinden-5-yl)sulfonyl-1,3-dioxoinden-2-yl]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 163236942) has the molecular formula C30H29NO10S and a molecular weight of 595.63 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[5-(1,3-dioxo-2-propanoylinden-5-yl)sulfonyl-1,3-dioxoinden-2-yl]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[5-(1,3-dioxo-2-propanoylinden-5-yl)sulfonyl-1,3-dioxoinden-2-yl]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 163236942 |
| Molecular Formula | C30H29NO10S |
| Molecular Weight | 595.63 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-[5-(1,3-dioxo-2-propanoylinden-5-yl)sulfonyl-1,3-dioxoinden-2-yl]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CCC(=O)C1C(=O)c2ccc(S(=O)(=O)c3ccc4c(c3)C(=O)C(C(=O)[C@H](C)N(C)C(=O)OC(C)(C)C)C4=O)cc2C1=O |
| InChI | InChI=1S/C30H29NO10S/c1-7-21(32)22-25(34)17-10-8-15(12-19(17)27(22)36)42(39,40)16-9-11-18-20(13-16)28(37)23(26(18)35)24(33)14(2)31(6)29(38)41-30(3,4)5/h8-14,22-23H,7H2,1-6H3/t14-,22?,23?/m0/s1 |
| InChIKey | BGJPPXXEZXOWRF-WVSTVCSASA-N |
| XLogP | 3.31 |
| TPSA | 166.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|