C22H34ClN5O2 — CID 163237865
N-(5-chloro-2-pyridinyl)-2-[3-(5-methoxypyrazin-2-yl)piperidin-1-yl]propanamide;ethane (PubChem CID 163237865) has the molecular formula C22H34ClN5O2 and a molecular weight of 436.00 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[3-(5-methoxypyrazin-2-yl)piperidin-1-yl]propanamide;ethane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[3-(5-methoxypyrazin-2-yl)piperidin-1-yl]propanamide;ethane |
|---|---|
| PubChem CID | 163237865 |
| Molecular Formula | C22H34ClN5O2 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[3-(5-methoxypyrazin-2-yl)piperidin-1-yl]propanamide;ethane |
| SMILES | CC.CC.COc1cnc(C2CCCN(C(C)C(=O)Nc3ccc(Cl)cn3)C2)cn1 |
| InChI | InChI=1S/C18H22ClN5O2.2C2H6/c1-12(18(25)23-16-6-5-14(19)8-21-16)24-7-3-4-13(11-24)15-9-22-17(26-2)10-20-15;2*1-2/h5-6,8-10,12-13H,3-4,7,11H2,1-2H3,(H,21,23,25);2*1-2H3 |
| InChIKey | PXEDCCZGBJWGQA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |