C18H21ClN4O2 — CID 164734825
(2S)-N-(5-chloro-2-pyridinyl)-2-[(3S)-3-(1-oxidopyridin-1-ium-4-yl)piperidin-1-yl]propanamide (PubChem CID 164734825) has the molecular formula C18H21ClN4O2 and a molecular weight of 360.85 g/mol. Its IUPAC name is (2S)-N-(5-chloro-2-pyridinyl)-2-[(3S)-3-(1-oxidopyridin-1-ium-4-yl)piperidin-1-yl]propanamide.
| Compound Name | (2S)-N-(5-chloro-2-pyridinyl)-2-[(3S)-3-(1-oxidopyridin-1-ium-4-yl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 164734825 |
| Molecular Formula | C18H21ClN4O2 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (2S)-N-(5-chloro-2-pyridinyl)-2-[(3S)-3-(1-oxidopyridin-1-ium-4-yl)piperidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(Cl)cn1)N1CCC[C@@H](c2cc[n+]([O-])cc2)C1 |
| InChI | InChI=1S/C18H21ClN4O2/c1-13(18(24)21-17-5-4-16(19)11-20-17)22-8-2-3-15(12-22)14-6-9-23(25)10-7-14/h4-7,9-11,13,15H,2-3,8,12H2,1H3,(H,20,21,24)/t13-,15+/m0/s1 |
| InChIKey | ABVBTUKAMCSMNY-DZGCQCFKSA-N |
| XLogP | 2.58 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|