C24H41ClN4O2 — CID 164584652
N-(5-chloro-2-pyridinyl)-2-[3-[(1Z)-3-hydroxy-1-(methylamino)buta-1,3-dienyl]piperidin-1-yl]propanamide;propane (PubChem CID 164584652) has the molecular formula C24H41ClN4O2 and a molecular weight of 453.07 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[3-[(1Z)-3-hydroxy-1-(methylamino)buta-1,3-dienyl]piperidin-1-yl]propanamide;propane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[3-[(1Z)-3-hydroxy-1-(methylamino)buta-1,3-dienyl]piperidin-1-yl]propanamide;propane |
|---|---|
| PubChem CID | 164584652 |
| Molecular Formula | C24H41ClN4O2 |
| Molecular Weight | 453.07 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[3-[(1Z)-3-hydroxy-1-(methylamino)buta-1,3-dienyl]piperidin-1-yl]propanamide;propane |
| SMILES | C=C(O)/C=C(\NC)C1CCCN(C(C)C(=O)Nc2ccc(Cl)cn2)C1.CCC.CCC |
| InChI | InChI=1S/C18H25ClN4O2.2C3H8/c1-12(24)9-16(20-3)14-5-4-8-23(11-14)13(2)18(25)22-17-7-6-15(19)10-21-17;2*1-3-2/h6-7,9-10,13-14,20,24H,1,4-5,8,11H2,2-3H3,(H,21,22,25);2*3H2,1-2H3/b16-9-;; |
| InChIKey | PVJOMLJCXUSPGJ-ULPVBNQHSA-N |
| XLogP | 5.78 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.07 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|