C24H35N5O10 — CID 163239014
2-[3-[2-hydroxyethyl-[2-[2-hydroxyethyl-[2-[2-methylpropyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoylamino]acetic acid (PubChem CID 163239014) has the molecular formula C24H35N5O10 and a molecular weight of 553.57 g/mol. Its IUPAC name is 2-[3-[2-hydroxyethyl-[2-[2-hydroxyethyl-[2-[2-methylpropyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoylamino]acetic acid.
| Compound Name | 2-[3-[2-hydroxyethyl-[2-[2-hydroxyethyl-[2-[2-methylpropyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 163239014 |
| Molecular Formula | C24H35N5O10 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[3-[2-hydroxyethyl-[2-[2-hydroxyethyl-[2-[2-methylpropyl-(4-nitrobenzoyl)amino]acetyl]amino]acetyl]amino]propanoylamino]acetic acid |
| SMILES | CC(C)CN(CC(=O)N(CCO)CC(=O)N(CCO)CCC(=O)NCC(=O)O)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H35N5O10/c1-17(2)14-28(24(37)18-3-5-19(6-4-18)29(38)39)16-22(34)27(10-12-31)15-21(33)26(9-11-30)8-7-20(32)25-13-23(35)36/h3-6,17,30-31H,7-16H2,1-2H3,(H,25,32)(H,35,36) |
| InChIKey | KNCDINQBOICANB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 210.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|