C18H25N3O4S — CID 3073747
N',N'-bis(2-methylpropyl)-N-(4-nitrobenzenecarbothioyl)propanediamide (PubChem CID 3073747) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N',N'-bis(2-methylpropyl)-N-(4-nitrobenzenecarbothioyl)propanediamide.
| Compound Name | N',N'-bis(2-methylpropyl)-N-(4-nitrobenzenecarbothioyl)propanediamide |
|---|---|
| PubChem CID | 3073747 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N',N'-bis(2-methylpropyl)-N-(4-nitrobenzenecarbothioyl)propanediamide |
| SMILES | CC(C)CN(CC(C)C)C(=O)CC(=O)NC(=S)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H25N3O4S/c1-12(2)10-20(11-13(3)4)17(23)9-16(22)19-18(26)14-5-7-15(8-6-14)21(24)25/h5-8,12-13H,9-11H2,1-4H3,(H,19,22,26) |
| InChIKey | CCMSCEBJPMCKAA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|