About 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane
2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane (PubChem CID 163239079) has the molecular formula C19H37F3N2
and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane.
Molecular Properties
| Compound Name | 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane |
| PubChem CID | 163239079 |
| Molecular Formula | C19H37F3N2 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.29 |
| IUPAC Name | 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane |
| SMILES | CC(C)F.CCN1CC2(C1)CC(F)(F)C2.CCN1CCC(C)(C)C1 |
| InChI | InChI=1S/C8H13F2N.C8H17N.C3H7F/c1-2-11-5-7(6-11)3-8(9,10)4-7;1-4-9-6-5-8(2,3)7-9;1-3(2)4/h2-6H2,1H3;4-7H2,1-3H3;3H,1-2H3 |
| InChIKey | MZGXQAPODFHZID-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane?
The IUPAC name of 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane (CID 163239079) is 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane.
What is the SMILES notation for 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane?
The canonical SMILES for 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane is CC(C)F.CCN1CC2(C1)CC(F)(F)C2.CCN1CCC(C)(C)C1.
What is the InChIKey of 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane?
The InChIKey is MZGXQAPODFHZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N.C8H17N.C3H7F/c1-2-11-5-7(6-11)3-8(9,10)4-7;1-4-9-6-5-8(2,3)7-9;1-3(2)4/h2-6H2,1H3;4-7H2,1-3H3;3H,1-2H3.
What are the key properties of 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane?
2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane has a molecular weight of 350.51 g/mol, XLogP of 4.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6,6-difluoro-2-azaspiro[3.3]heptane;1-ethyl-3,3-dimethylpyrrolidine;2-fluoropropane is sourced from PubChem (CID 163239079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).