About [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal
[2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal (PubChem CID 163239741) has the molecular formula C19H23NO3
and a molecular weight of 313.40 g/mol. Its IUPAC name is [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal.
Molecular Properties
| Compound Name | [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal |
| PubChem CID | 163239741 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal |
| SMILES | CCC=O.Cc1cc(O)ccc1C(=O)c1ccccc1N(C)C |
| InChI | InChI=1S/C16H17NO2.C3H6O/c1-11-10-12(18)8-9-13(11)16(19)14-6-4-5-7-15(14)17(2)3;1-2-3-4/h4-10,18H,1-3H3;3H,2H2,1H3 |
| InChIKey | BSUXWDAPJRHYSF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal?
The IUPAC name of [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal (CID 163239741) is [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal.
What is the SMILES notation for [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal?
The canonical SMILES for [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal is CCC=O.Cc1cc(O)ccc1C(=O)c1ccccc1N(C)C.
What is the InChIKey of [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal?
The InChIKey is BSUXWDAPJRHYSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2.C3H6O/c1-11-10-12(18)8-9-13(11)16(19)14-6-4-5-7-15(14)17(2)3;1-2-3-4/h4-10,18H,1-3H3;3H,2H2,1H3.
What are the key properties of [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal?
[2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal has a molecular weight of 313.40 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)phenyl]-(4-hydroxy-2-methylphenyl)methanone;propanal is sourced from PubChem (CID 163239741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).