5-(methylsulfamoyl)thiophene-2-sulfonyl chloride

C5H6ClNO4S3 — CID 163241520

IUPAC5-(methylsulfamoyl)thiophene-2-sulfonyl chloride
SMILESCNS(=O)(=O)c1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C5H6ClNO4S3/c1-7-14(10,11)5-3-2-4(12-5)13(6,8)9/h2-3,7H,1H3
InChIKeyXQQYYDSDXWRETJ-UHFFFAOYSA-N
MW275.76 g/mol
LogP0.58
Rot. Bonds3

About 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride

5-(methylsulfamoyl)thiophene-2-sulfonyl chloride (PubChem CID 163241520) has the molecular formula C5H6ClNO4S3 and a molecular weight of 275.76 g/mol. Its IUPAC name is 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride.

Molecular Properties

Compound Name5-(methylsulfamoyl)thiophene-2-sulfonyl chloride
PubChem CID163241520
Molecular FormulaC5H6ClNO4S3
Molecular Weight275.76 g/mol
Exact Mass274.91
IUPAC Name5-(methylsulfamoyl)thiophene-2-sulfonyl chloride
SMILESCNS(=O)(=O)c1ccc(S(=O)(=O)Cl)s1
InChIInChI=1S/C5H6ClNO4S3/c1-7-14(10,11)5-3-2-4(12-5)13(6,8)9/h2-3,7H,1H3
InChIKeyXQQYYDSDXWRETJ-UHFFFAOYSA-N
XLogP0.58
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.76
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride?
The IUPAC name of 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride (CID 163241520) is 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride.
What is the SMILES notation for 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride?
The canonical SMILES for 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride is CNS(=O)(=O)c1ccc(S(=O)(=O)Cl)s1.
What is the InChIKey of 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride?
The InChIKey is XQQYYDSDXWRETJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6ClNO4S3/c1-7-14(10,11)5-3-2-4(12-5)13(6,8)9/h2-3,7H,1H3.
What are the key properties of 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride?
5-(methylsulfamoyl)thiophene-2-sulfonyl chloride has a molecular weight of 275.76 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylsulfamoyl)thiophene-2-sulfonyl chloride is sourced from PubChem (CID 163241520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).