C19H17ClN4O5S — CID 163243026
3-[2-[(3-aminophenyl)sulfonylamino]-6-chloro-5-ethylpyrimidin-4-yl]oxybenzoic acid (PubChem CID 163243026) has the molecular formula C19H17ClN4O5S and a molecular weight of 448.89 g/mol. Its IUPAC name is 3-[2-[(3-aminophenyl)sulfonylamino]-6-chloro-5-ethylpyrimidin-4-yl]oxybenzoic acid.
| Compound Name | 3-[2-[(3-aminophenyl)sulfonylamino]-6-chloro-5-ethylpyrimidin-4-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 163243026 |
| Molecular Formula | C19H17ClN4O5S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-[2-[(3-aminophenyl)sulfonylamino]-6-chloro-5-ethylpyrimidin-4-yl]oxybenzoic acid |
| SMILES | CCc1c(Cl)nc(NS(=O)(=O)c2cccc(N)c2)nc1Oc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H17ClN4O5S/c1-2-15-16(20)22-19(24-30(27,28)14-8-4-6-12(21)10-14)23-17(15)29-13-7-3-5-11(9-13)18(25)26/h3-10H,2,21H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | YLXGOWMXJAVXJY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|