C23H17N5O3S — CID 170393200
3-amino-N-[5-(2-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide (PubChem CID 170393200) has the molecular formula C23H17N5O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is 3-amino-N-[5-(2-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[5-(2-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170393200 |
| Molecular Formula | C23H17N5O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-amino-N-[5-(2-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1-c1cnc(NS(=O)(=O)c2cccc(N)c2)nc1Oc1ccccc1 |
| InChI | InChI=1S/C23H17N5O3S/c24-14-16-7-4-5-12-20(16)21-15-26-23(27-22(21)31-18-9-2-1-3-10-18)28-32(29,30)19-11-6-8-17(25)13-19/h1-13,15H,25H2,(H,26,27,28) |
| InChIKey | CUDSJIDMOPSVKP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|