C23H16N4O3S — CID 170393219
N-[5-(4-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide (PubChem CID 170393219) has the molecular formula C23H16N4O3S and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[5-(4-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170393219 |
| Molecular Formula | C23H16N4O3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[5-(4-cyanophenyl)-4-phenoxypyrimidin-2-yl]benzenesulfonamide |
| SMILES | N#Cc1ccc(-c2cnc(NS(=O)(=O)c3ccccc3)nc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H16N4O3S/c24-15-17-11-13-18(14-12-17)21-16-25-23(26-22(21)30-19-7-3-1-4-8-19)27-31(28,29)20-9-5-2-6-10-20/h1-14,16H,(H,25,26,27) |
| InChIKey | FZLCYSGAKLQSML-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |