C21H17N5O3S — CID 170394362
N-[4-(6-amino-3-pyridinyl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide (PubChem CID 170394362) has the molecular formula C21H17N5O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is N-[4-(6-amino-3-pyridinyl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide.
| Compound Name | N-[4-(6-amino-3-pyridinyl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170394362 |
| Molecular Formula | C21H17N5O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | N-[4-(6-amino-3-pyridinyl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
| SMILES | Nc1ccc(-c2cc(Oc3ccccc3)nc(NS(=O)(=O)c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C21H17N5O3S/c22-19-12-11-15(14-23-19)18-13-20(29-16-7-3-1-4-8-16)25-21(24-18)26-30(27,28)17-9-5-2-6-10-17/h1-14H,(H2,22,23)(H,24,25,26) |
| InChIKey | GSUDBLUSQOSCKP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 120.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |