C19H14N4O3S2 — CID 170395225
N-(4-phenoxy-6-phenylpyrimidin-2-yl)-1,3-thiazole-5-sulfonamide (PubChem CID 170395225) has the molecular formula C19H14N4O3S2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-(4-phenoxy-6-phenylpyrimidin-2-yl)-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(4-phenoxy-6-phenylpyrimidin-2-yl)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 170395225 |
| Molecular Formula | C19H14N4O3S2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(4-phenoxy-6-phenylpyrimidin-2-yl)-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(Nc1nc(Oc2ccccc2)cc(-c2ccccc2)n1)c1cncs1 |
| InChI | InChI=1S/C19H14N4O3S2/c24-28(25,18-12-20-13-27-18)23-19-21-16(14-7-3-1-4-8-14)11-17(22-19)26-15-9-5-2-6-10-15/h1-13H,(H,21,22,23) |
| InChIKey | CRYBZSCOYYLGNL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |