C23H19N3O3S — CID 170392795
N-[4-(4-methylphenoxy)-6-phenylpyrimidin-2-yl]benzenesulfonamide (PubChem CID 170392795) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[4-(4-methylphenoxy)-6-phenylpyrimidin-2-yl]benzenesulfonamide.
| Compound Name | N-[4-(4-methylphenoxy)-6-phenylpyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170392795 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[4-(4-methylphenoxy)-6-phenylpyrimidin-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc(Oc2cc(-c3ccccc3)nc(NS(=O)(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19N3O3S/c1-17-12-14-19(15-13-17)29-22-16-21(18-8-4-2-5-9-18)24-23(25-22)26-30(27,28)20-10-6-3-7-11-20/h2-16H,1H3,(H,24,25,26) |
| InChIKey | CZBNMTVCUCNTJU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |