C20H15N3O4S — CID 170415389
N-[4-(furan-3-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide (PubChem CID 170415389) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is N-[4-(furan-3-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide.
| Compound Name | N-[4-(furan-3-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170415389 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-[4-(furan-3-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(Oc2ccccc2)cc(-c2ccoc2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H15N3O4S/c24-28(25,17-9-5-2-6-10-17)23-20-21-18(15-11-12-26-14-15)13-19(22-20)27-16-7-3-1-4-8-16/h1-14H,(H,21,22,23) |
| InChIKey | BROXUZNEGJRYQJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |