C23H25N3O4S — CID 163247827
N-[4-(4,4-dimethyloxan-2-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide (PubChem CID 163247827) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[4-(4,4-dimethyloxan-2-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide.
| Compound Name | N-[4-(4,4-dimethyloxan-2-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163247827 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[4-(4,4-dimethyloxan-2-yl)-6-phenoxypyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC1(C)CCOC(c2cc(Oc3ccccc3)nc(NS(=O)(=O)c3ccccc3)n2)C1 |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2)13-14-29-20(16-23)19-15-21(30-17-9-5-3-6-10-17)25-22(24-19)26-31(27,28)18-11-7-4-8-12-18/h3-12,15,20H,13-14,16H2,1-2H3,(H,24,25,26) |
| InChIKey | BEHDUDSBDHWDDO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |