C23H26N4O4S — CID 170395201
4-(methoxymethyl)-N-(4-phenoxy-6-phenylpyrimidin-2-yl)piperidine-1-sulfonamide (PubChem CID 170395201) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-(4-phenoxy-6-phenylpyrimidin-2-yl)piperidine-1-sulfonamide.
| Compound Name | 4-(methoxymethyl)-N-(4-phenoxy-6-phenylpyrimidin-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 170395201 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-(methoxymethyl)-N-(4-phenoxy-6-phenylpyrimidin-2-yl)piperidine-1-sulfonamide |
| SMILES | COCC1CCN(S(=O)(=O)Nc2nc(Oc3ccccc3)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H26N4O4S/c1-30-17-18-12-14-27(15-13-18)32(28,29)26-23-24-21(19-8-4-2-5-9-19)16-22(25-23)31-20-10-6-3-7-11-20/h2-11,16,18H,12-15,17H2,1H3,(H,24,25,26) |
| InChIKey | NHUQPMUGWLKGIY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |