C7H9Cl2N3O — CID 163243179
4,6-dichloro-5-propan-2-yloxypyrimidin-2-amine (PubChem CID 163243179) has the molecular formula C7H9Cl2N3O and a molecular weight of 222.07 g/mol. Its IUPAC name is 4,6-dichloro-5-propan-2-yloxypyrimidin-2-amine.
| Compound Name | 4,6-dichloro-5-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 163243179 |
| Molecular Formula | C7H9Cl2N3O |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 4,6-dichloro-5-propan-2-yloxypyrimidin-2-amine |
| SMILES | CC(C)Oc1c(Cl)nc(N)nc1Cl |
| InChI | InChI=1S/C7H9Cl2N3O/c1-3(2)13-4-5(8)11-7(10)12-6(4)9/h3H,1-2H3,(H2,10,11,12) |
| InChIKey | UZFQUTVHWXANKG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |