C24H32ClN5O5SSi — CID 163243889
ethyl 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate (PubChem CID 163243889) has the molecular formula C24H32ClN5O5SSi and a molecular weight of 566.16 g/mol. Its IUPAC name is ethyl 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 163243889 |
| Molecular Formula | C24H32ClN5O5SSi |
| Molecular Weight | 566.16 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | ethyl 5-[[4-chloro-6-(2,6-dimethylphenyl)pyrimidin-2-yl]sulfamoyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)Nc2nc(Cl)cc(-c3c(C)cccc3C)n2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C24H32ClN5O5SSi/c1-7-35-23(31)19-14-21(30(28-19)15-34-11-12-37(4,5)6)36(32,33)29-24-26-18(13-20(25)27-24)22-16(2)9-8-10-17(22)3/h8-10,13-14H,7,11-12,15H2,1-6H3,(H,26,27,29) |
| InChIKey | QWFRYQUHDCVYGA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|