C11H13NO3 — CID 163245849
2-methyl-5,6-dihydroisoindole-1,3-dione;oxirane (PubChem CID 163245849) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-methyl-5,6-dihydroisoindole-1,3-dione;oxirane.
| Compound Name | 2-methyl-5,6-dihydroisoindole-1,3-dione;oxirane |
|---|---|
| PubChem CID | 163245849 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-methyl-5,6-dihydroisoindole-1,3-dione;oxirane |
| SMILES | C1CO1.CN1C(=O)C2=CCCC=C2C1=O |
| InChI | InChI=1S/C9H9NO2.C2H4O/c1-10-8(11)6-4-2-3-5-7(6)9(10)12;1-2-3-1/h4-5H,2-3H2,1H3;1-2H2 |
| InChIKey | QABWOSALOIUBDF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|